C16H10N4O3 — CID 162640026
4-[[5-(4-nitrophenyl)-1,3-oxazol-2-yl]amino]benzonitrile (PubChem CID 162640026) has the molecular formula C16H10N4O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 4-[[5-(4-nitrophenyl)-1,3-oxazol-2-yl]amino]benzonitrile.
| Compound Name | 4-[[5-(4-nitrophenyl)-1,3-oxazol-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 162640026 |
| Molecular Formula | C16H10N4O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-[[5-(4-nitrophenyl)-1,3-oxazol-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2ncc(-c3ccc([N+](=O)[O-])cc3)o2)cc1 |
| InChI | InChI=1S/C16H10N4O3/c17-9-11-1-5-13(6-2-11)19-16-18-10-15(23-16)12-3-7-14(8-4-12)20(21)22/h1-8,10H,(H,18,19) |
| InChIKey | GMLOBUXFXCTUTK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|