C18H13F3N4O2S — CID 162591343
4-[2-[3-[[methylidene-oxo-(trifluoromethyl)-λ6-sulfanyl]amino]anilino]-1,3-oxazol-5-yl]benzonitrile (PubChem CID 162591343) has the molecular formula C18H13F3N4O2S and a molecular weight of 406.39 g/mol. Its IUPAC name is 4-[2-[3-[[methylidene-oxo-(trifluoromethyl)-λ6-sulfanyl]amino]anilino]-1,3-oxazol-5-yl]benzonitrile.
| Compound Name | 4-[2-[3-[[methylidene-oxo-(trifluoromethyl)-λ6-sulfanyl]amino]anilino]-1,3-oxazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 162591343 |
| Molecular Formula | C18H13F3N4O2S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 4-[2-[3-[[methylidene-oxo-(trifluoromethyl)-λ6-sulfanyl]amino]anilino]-1,3-oxazol-5-yl]benzonitrile |
| SMILES | C=S(=O)(Nc1cccc(Nc2ncc(-c3ccc(C#N)cc3)o2)c1)C(F)(F)F |
| InChI | InChI=1S/C18H13F3N4O2S/c1-28(26,18(19,20)21)25-15-4-2-3-14(9-15)24-17-23-11-16(27-17)13-7-5-12(10-22)6-8-13/h2-9,11H,1H2,(H,23,24)(H,25,26) |
| InChIKey | PMQAWQSHJLVTFC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|