C18H13N3O3 — CID 149111771
4-[2-[(2-methyl-5-nitrophenyl)methyl]-1,3-oxazol-5-yl]benzonitrile (PubChem CID 149111771) has the molecular formula C18H13N3O3 and a molecular weight of 319.32 g/mol. Its IUPAC name is 4-[2-[(2-methyl-5-nitrophenyl)methyl]-1,3-oxazol-5-yl]benzonitrile.
| Compound Name | 4-[2-[(2-methyl-5-nitrophenyl)methyl]-1,3-oxazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 149111771 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 4-[2-[(2-methyl-5-nitrophenyl)methyl]-1,3-oxazol-5-yl]benzonitrile |
| SMILES | Cc1ccc([N+](=O)[O-])cc1Cc1ncc(-c2ccc(C#N)cc2)o1 |
| InChI | InChI=1S/C18H13N3O3/c1-12-2-7-16(21(22)23)8-15(12)9-18-20-11-17(24-18)14-5-3-13(10-19)4-6-14/h2-8,11H,9H2,1H3 |
| InChIKey | QXJXRSMTGHUXPL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 92.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|