C17H14ClN3O3 — CID 36587372
N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]-2-methyl-5-nitroaniline (PubChem CID 36587372) has the molecular formula C17H14ClN3O3 and a molecular weight of 343.77 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]-2-methyl-5-nitroaniline.
| Compound Name | N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]-2-methyl-5-nitroaniline |
|---|---|
| PubChem CID | 36587372 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl]-2-methyl-5-nitroaniline |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NCc1ncc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C17H14ClN3O3/c1-11-2-7-14(21(22)23)8-15(11)19-10-17-20-9-16(24-17)12-3-5-13(18)6-4-12/h2-9,19H,10H2,1H3 |
| InChIKey | FEYNMPJKMLGMNJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|