C17H12N2O5S — CID 21408973
2-[5-[4-(4-nitrophenyl)phenyl]-1,3-oxazol-2-yl]-2-sulfanylacetic acid (PubChem CID 21408973) has the molecular formula C17H12N2O5S and a molecular weight of 356.36 g/mol. Its IUPAC name is 2-[5-[4-(4-nitrophenyl)phenyl]-1,3-oxazol-2-yl]-2-sulfanylacetic acid.
| Compound Name | 2-[5-[4-(4-nitrophenyl)phenyl]-1,3-oxazol-2-yl]-2-sulfanylacetic acid |
|---|---|
| PubChem CID | 21408973 |
| Molecular Formula | C17H12N2O5S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-[5-[4-(4-nitrophenyl)phenyl]-1,3-oxazol-2-yl]-2-sulfanylacetic acid |
| SMILES | O=C(O)C(S)c1ncc(-c2ccc(-c3ccc([N+](=O)[O-])cc3)cc2)o1 |
| InChI | InChI=1S/C17H12N2O5S/c20-17(21)15(25)16-18-9-14(24-16)12-3-1-10(2-4-12)11-5-7-13(8-6-11)19(22)23/h1-9,15,25H,(H,20,21) |
| InChIKey | IEFXJCHBHBMRJZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|