C18H16N2O5S — CID 21408617
5-[4-(4-nitrophenyl)phenyl]-1,3-oxazole;2-sulfanylpropanoic acid (PubChem CID 21408617) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is 5-[4-(4-nitrophenyl)phenyl]-1,3-oxazole;2-sulfanylpropanoic acid.
| Compound Name | 5-[4-(4-nitrophenyl)phenyl]-1,3-oxazole;2-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 21408617 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 5-[4-(4-nitrophenyl)phenyl]-1,3-oxazole;2-sulfanylpropanoic acid |
| SMILES | CC(S)C(=O)O.O=[N+]([O-])c1ccc(-c2ccc(-c3cnco3)cc2)cc1 |
| InChI | InChI=1S/C15H10N2O3.C3H6O2S/c18-17(19)14-7-5-12(6-8-14)11-1-3-13(4-2-11)15-9-16-10-20-15;1-2(6)3(4)5/h1-10H;2,6H,1H3,(H,4,5) |
| InChIKey | GPMLCBQIQIPTIK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|