C11H9N3O5 — CID 54435683
(4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid (PubChem CID 54435683) has the molecular formula C11H9N3O5 and a molecular weight of 263.21 g/mol. Its IUPAC name is (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid.
| Compound Name | (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid |
|---|---|
| PubChem CID | 54435683 |
| Molecular Formula | C11H9N3O5 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid |
| SMILES | O=C(O)N(Cc1cnco1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H9N3O5/c15-11(16)13(6-10-5-12-7-19-10)8-1-3-9(4-2-8)14(17)18/h1-5,7H,6H2,(H,15,16) |
| InChIKey | WKOHQLHMZUSGCX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 109.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|