About (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid
(4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid (PubChem CID 54435683) has the molecular formula C11H9N3O5
and a molecular weight of 263.21 g/mol. Its IUPAC name is (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid.
Molecular Properties
| Compound Name | (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid |
| PubChem CID | 54435683 |
| Molecular Formula | C11H9N3O5 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid |
| SMILES | O=C(O)N(Cc1cnco1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H9N3O5/c15-11(16)13(6-10-5-12-7-19-10)8-1-3-9(4-2-8)14(17)18/h1-5,7H,6H2,(H,15,16) |
| InChIKey | WKOHQLHMZUSGCX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 109.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid?
The IUPAC name of (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid (CID 54435683) is (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid.
What is the SMILES notation for (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid?
The canonical SMILES for (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid is O=C(O)N(Cc1cnco1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid?
The InChIKey is WKOHQLHMZUSGCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3O5/c15-11(16)13(6-10-5-12-7-19-10)8-1-3-9(4-2-8)14(17)18/h1-5,7H,6H2,(H,15,16).
What are the key properties of (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid?
(4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid has a molecular weight of 263.21 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)-(1,3-oxazol-5-ylmethyl)carbamic acid is sourced from PubChem (CID 54435683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).