C18H16FNO3S — CID 21408827
5-[4-(4-fluorophenyl)phenyl]-1,3-oxazole;2-sulfanylpropanoic acid (PubChem CID 21408827) has the molecular formula C18H16FNO3S and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-[4-(4-fluorophenyl)phenyl]-1,3-oxazole;2-sulfanylpropanoic acid.
| Compound Name | 5-[4-(4-fluorophenyl)phenyl]-1,3-oxazole;2-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 21408827 |
| Molecular Formula | C18H16FNO3S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 5-[4-(4-fluorophenyl)phenyl]-1,3-oxazole;2-sulfanylpropanoic acid |
| SMILES | CC(S)C(=O)O.Fc1ccc(-c2ccc(-c3cnco3)cc2)cc1 |
| InChI | InChI=1S/C15H10FNO.C3H6O2S/c16-14-7-5-12(6-8-14)11-1-3-13(4-2-11)15-9-17-10-18-15;1-2(6)3(4)5/h1-10H;2,6H,1H3,(H,4,5) |
| InChIKey | XNWCYQQYEORTCI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|