C18H17NO4S — CID 21409103
4-[4-(1,3-oxazol-5-yl)phenyl]phenol;2-sulfanylpropanoic acid (PubChem CID 21409103) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is 4-[4-(1,3-oxazol-5-yl)phenyl]phenol;2-sulfanylpropanoic acid.
| Compound Name | 4-[4-(1,3-oxazol-5-yl)phenyl]phenol;2-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 21409103 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-[4-(1,3-oxazol-5-yl)phenyl]phenol;2-sulfanylpropanoic acid |
| SMILES | CC(S)C(=O)O.Oc1ccc(-c2ccc(-c3cnco3)cc2)cc1 |
| InChI | InChI=1S/C15H11NO2.C3H6O2S/c17-14-7-5-12(6-8-14)11-1-3-13(4-2-11)15-9-16-10-18-15;1-2(6)3(4)5/h1-10,17H;2,6H,1H3,(H,4,5) |
| InChIKey | PAYDSDRCFCVGGG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|