C15H15NO4 — CID 97313933
[(2S)-3-oxopentan-2-yl] 4-(1,3-oxazol-5-yl)benzoate (PubChem CID 97313933) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is [(2S)-3-oxopentan-2-yl] 4-(1,3-oxazol-5-yl)benzoate.
| Compound Name | [(2S)-3-oxopentan-2-yl] 4-(1,3-oxazol-5-yl)benzoate |
|---|---|
| PubChem CID | 97313933 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [(2S)-3-oxopentan-2-yl] 4-(1,3-oxazol-5-yl)benzoate |
| SMILES | CCC(=O)[C@H](C)OC(=O)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C15H15NO4/c1-3-13(17)10(2)20-15(18)12-6-4-11(5-7-12)14-8-16-9-19-14/h4-10H,3H2,1-2H3/t10-/m0/s1 |
| InChIKey | FWNOFTLGHXGVEO-JTQLQIEISA-N |
| XLogP | 2.87 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |