About propan-2-yl 4-(furan-2-yl)benzoate
propan-2-yl 4-(furan-2-yl)benzoate (PubChem CID 168528785) has the molecular formula C14H14O3
and a molecular weight of 230.26 g/mol. Its IUPAC name is propan-2-yl 4-(furan-2-yl)benzoate.
Molecular Properties
| Compound Name | propan-2-yl 4-(furan-2-yl)benzoate |
| PubChem CID | 168528785 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | propan-2-yl 4-(furan-2-yl)benzoate |
| SMILES | CC(C)OC(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C14H14O3/c1-10(2)17-14(15)12-7-5-11(6-8-12)13-4-3-9-16-13/h3-10H,1-2H3 |
| InChIKey | UENLORMECFPICE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 4-(furan-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-(furan-2-yl)benzoate?
The IUPAC name of propan-2-yl 4-(furan-2-yl)benzoate (CID 168528785) is propan-2-yl 4-(furan-2-yl)benzoate.
What is the SMILES notation for propan-2-yl 4-(furan-2-yl)benzoate?
The canonical SMILES for propan-2-yl 4-(furan-2-yl)benzoate is CC(C)OC(=O)c1ccc(-c2ccco2)cc1.
What is the InChIKey of propan-2-yl 4-(furan-2-yl)benzoate?
The InChIKey is UENLORMECFPICE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3/c1-10(2)17-14(15)12-7-5-11(6-8-12)13-4-3-9-16-13/h3-10H,1-2H3.
What are the key properties of propan-2-yl 4-(furan-2-yl)benzoate?
propan-2-yl 4-(furan-2-yl)benzoate has a molecular weight of 230.26 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-(furan-2-yl)benzoate is sourced from PubChem (CID 168528785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).