C18H13N3O7S — CID 21408803
2-[[4,5-bis(4-nitrophenyl)-1,3-oxazol-2-yl]sulfanyl]propanoic acid (PubChem CID 21408803) has the molecular formula C18H13N3O7S and a molecular weight of 415.38 g/mol. Its IUPAC name is 2-[[4,5-bis(4-nitrophenyl)-1,3-oxazol-2-yl]sulfanyl]propanoic acid.
| Compound Name | 2-[[4,5-bis(4-nitrophenyl)-1,3-oxazol-2-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 21408803 |
| Molecular Formula | C18H13N3O7S |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 2-[[4,5-bis(4-nitrophenyl)-1,3-oxazol-2-yl]sulfanyl]propanoic acid |
| SMILES | CC(Sc1nc(-c2ccc([N+](=O)[O-])cc2)c(-c2ccc([N+](=O)[O-])cc2)o1)C(=O)O |
| InChI | InChI=1S/C18H13N3O7S/c1-10(17(22)23)29-18-19-15(11-2-6-13(7-3-11)20(24)25)16(28-18)12-4-8-14(9-5-12)21(26)27/h2-10H,1H3,(H,22,23) |
| InChIKey | HUFJXHQRJFDNEL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 149.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|