C24H25NO4S — CID 170076801
(E)-2-[[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]sulfanyl]hept-4-en-3-one (PubChem CID 170076801) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is (E)-2-[[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]sulfanyl]hept-4-en-3-one.
| Compound Name | (E)-2-[[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]sulfanyl]hept-4-en-3-one |
|---|---|
| PubChem CID | 170076801 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (E)-2-[[4,5-bis(4-methoxyphenyl)-1,3-oxazol-2-yl]sulfanyl]hept-4-en-3-one |
| SMILES | CC/C=C/C(=O)C(C)Sc1nc(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)o1 |
| InChI | InChI=1S/C24H25NO4S/c1-5-6-7-21(26)16(2)30-24-25-22(17-8-12-19(27-3)13-9-17)23(29-24)18-10-14-20(28-4)15-11-18/h6-16H,5H2,1-4H3/b7-6+ |
| InChIKey | CXECYPZRKRUULB-VOTSOKGWSA-N |
| XLogP | 6.04 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|