C24H17Cl3N2O2S — CID 2378053
(2S)-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 2378053) has the molecular formula C24H17Cl3N2O2S and a molecular weight of 503.84 g/mol. Its IUPAC name is (2S)-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | (2S)-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 2378053 |
| Molecular Formula | C24H17Cl3N2O2S |
| Molecular Weight | 503.84 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | (2S)-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | C[C@H](Sc1nc(-c2ccccc2)c(-c2ccccc2)o1)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C24H17Cl3N2O2S/c1-14(23(30)28-20-13-18(26)17(25)12-19(20)27)32-24-29-21(15-8-4-2-5-9-15)22(31-24)16-10-6-3-7-11-16/h2-14H,1H3,(H,28,30)/t14-/m0/s1 |
| InChIKey | XZRHSCHHNJTQRM-AWEZNQCLSA-N |
| XLogP | 8.09 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.84 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|