C17H13Cl3N4OS — CID 16529694
2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 16529694) has the molecular formula C17H13Cl3N4OS and a molecular weight of 427.74 g/mol. Its IUPAC name is 2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | 2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 16529694 |
| Molecular Formula | C17H13Cl3N4OS |
| Molecular Weight | 427.74 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | CC(Sc1nncn1-c1ccccc1)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H13Cl3N4OS/c1-10(16(25)22-15-8-13(19)12(18)7-14(15)20)26-17-23-21-9-24(17)11-5-3-2-4-6-11/h2-10H,1H3,(H,22,25) |
| InChIKey | JJXZEECVRJSPLU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.74 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|