C12H11Cl3N4OS — CID 2339958
(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 2339958) has the molecular formula C12H11Cl3N4OS and a molecular weight of 365.67 g/mol. Its IUPAC name is (2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | (2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 2339958 |
| Molecular Formula | C12H11Cl3N4OS |
| Molecular Weight | 365.67 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | (2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | C[C@H](Sc1nncn1C)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl3N4OS/c1-6(21-12-18-16-5-19(12)2)11(20)17-10-4-8(14)7(13)3-9(10)15/h3-6H,1-2H3,(H,17,20)/t6-/m0/s1 |
| InChIKey | SHOJPICCUPBPSD-LURJTMIESA-N |
| XLogP | 3.89 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.67 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|