C19H17ClN6O4S — CID 46574453
2-[[4-(3-acetamidophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)propanamide (PubChem CID 46574453) has the molecular formula C19H17ClN6O4S and a molecular weight of 460.90 g/mol. Its IUPAC name is 2-[[4-(3-acetamidophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)propanamide.
| Compound Name | 2-[[4-(3-acetamidophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 46574453 |
| Molecular Formula | C19H17ClN6O4S |
| Molecular Weight | 460.90 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 2-[[4-(3-acetamidophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-5-nitrophenyl)propanamide |
| SMILES | CC(=O)Nc1cccc(-n2cnnc2SC(C)C(=O)Nc2cc([N+](=O)[O-])ccc2Cl)c1 |
| InChI | InChI=1S/C19H17ClN6O4S/c1-11(18(28)23-17-9-15(26(29)30)6-7-16(17)20)31-19-24-21-10-25(19)14-5-3-4-13(8-14)22-12(2)27/h3-11H,1-2H3,(H,22,27)(H,23,28) |
| InChIKey | XIJHPSOGBGBUFV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|