C19H15Cl3N2OS — CID 2420043
(2S)-2-(4-methylquinolin-2-yl)sulfanyl-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 2420043) has the molecular formula C19H15Cl3N2OS and a molecular weight of 425.77 g/mol. Its IUPAC name is (2S)-2-(4-methylquinolin-2-yl)sulfanyl-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | (2S)-2-(4-methylquinolin-2-yl)sulfanyl-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 2420043 |
| Molecular Formula | C19H15Cl3N2OS |
| Molecular Weight | 425.77 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | (2S)-2-(4-methylquinolin-2-yl)sulfanyl-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | Cc1cc(S[C@@H](C)C(=O)Nc2cc(Cl)c(Cl)cc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C19H15Cl3N2OS/c1-10-7-18(23-16-6-4-3-5-12(10)16)26-11(2)19(25)24-17-9-14(21)13(20)8-15(17)22/h3-9,11H,1-2H3,(H,24,25)/t11-/m0/s1 |
| InChIKey | RKEUVDOZOQTFFI-NSHDSACASA-N |
| XLogP | 6.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.77 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|