C25H22N2O2S — CID 3557418
2-(4-methylquinolin-2-yl)sulfanyl-N-(4-phenoxyphenyl)propanamide (PubChem CID 3557418) has the molecular formula C25H22N2O2S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-(4-methylquinolin-2-yl)sulfanyl-N-(4-phenoxyphenyl)propanamide.
| Compound Name | 2-(4-methylquinolin-2-yl)sulfanyl-N-(4-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 3557418 |
| Molecular Formula | C25H22N2O2S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-(4-methylquinolin-2-yl)sulfanyl-N-(4-phenoxyphenyl)propanamide |
| SMILES | Cc1cc(SC(C)C(=O)Nc2ccc(Oc3ccccc3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C25H22N2O2S/c1-17-16-24(27-23-11-7-6-10-22(17)23)30-18(2)25(28)26-19-12-14-21(15-13-19)29-20-8-4-3-5-9-20/h3-16,18H,1-2H3,(H,26,28) |
| InChIKey | KIGLQLJCRKNOPQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |