C27H26N2O2S — CID 46302008
2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(4-phenoxyphenyl)butanamide (PubChem CID 46302008) has the molecular formula C27H26N2O2S and a molecular weight of 442.58 g/mol. Its IUPAC name is 2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(4-phenoxyphenyl)butanamide.
| Compound Name | 2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(4-phenoxyphenyl)butanamide |
|---|---|
| PubChem CID | 46302008 |
| Molecular Formula | C27H26N2O2S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(4-phenoxyphenyl)butanamide |
| SMILES | CCC(Sc1cc(C)c2cccc(C)c2n1)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N2O2S/c1-4-24(32-25-17-19(3)23-12-8-9-18(2)26(23)29-25)27(30)28-20-13-15-22(16-14-20)31-21-10-6-5-7-11-21/h5-17,24H,4H2,1-3H3,(H,28,30) |
| InChIKey | IWDFPUOHCDEDEP-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |