C21H22N2O2S — CID 46302009
2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(4-hydroxyphenyl)butanamide (PubChem CID 46302009) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(4-hydroxyphenyl)butanamide.
| Compound Name | 2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(4-hydroxyphenyl)butanamide |
|---|---|
| PubChem CID | 46302009 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-(4-hydroxyphenyl)butanamide |
| SMILES | CCC(Sc1cc(C)c2cccc(C)c2n1)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C21H22N2O2S/c1-4-18(21(25)22-15-8-10-16(24)11-9-15)26-19-12-14(3)17-7-5-6-13(2)20(17)23-19/h5-12,18,24H,4H2,1-3H3,(H,22,25) |
| InChIKey | PLWADLRJVYHYJF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|