C24H28N2OS — CID 46302158
N-(4-ethylphenyl)-2-(4,6,8-trimethylquinolin-2-yl)sulfanylbutanamide (PubChem CID 46302158) has the molecular formula C24H28N2OS and a molecular weight of 392.57 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-(4,6,8-trimethylquinolin-2-yl)sulfanylbutanamide.
| Compound Name | N-(4-ethylphenyl)-2-(4,6,8-trimethylquinolin-2-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 46302158 |
| Molecular Formula | C24H28N2OS |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-(4-ethylphenyl)-2-(4,6,8-trimethylquinolin-2-yl)sulfanylbutanamide |
| SMILES | CCc1ccc(NC(=O)C(CC)Sc2cc(C)c3cc(C)cc(C)c3n2)cc1 |
| InChI | InChI=1S/C24H28N2OS/c1-6-18-8-10-19(11-9-18)25-24(27)21(7-2)28-22-14-16(4)20-13-15(3)12-17(5)23(20)26-22/h8-14,21H,6-7H2,1-5H3,(H,25,27) |
| InChIKey | ZJQIXTQUGJLIQX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |