C25H29N3O2S2 — CID 46302269
2-[2-(4,6,8-trimethylquinolin-2-yl)sulfanylbutanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 46302269) has the molecular formula C25H29N3O2S2 and a molecular weight of 467.66 g/mol. Its IUPAC name is 2-[2-(4,6,8-trimethylquinolin-2-yl)sulfanylbutanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[2-(4,6,8-trimethylquinolin-2-yl)sulfanylbutanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 46302269 |
| Molecular Formula | C25H29N3O2S2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-[2-(4,6,8-trimethylquinolin-2-yl)sulfanylbutanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCC(Sc1cc(C)c2cc(C)cc(C)c2n1)C(=O)Nc1sc2c(c1C(N)=O)CCCC2 |
| InChI | InChI=1S/C25H29N3O2S2/c1-5-18(31-20-12-14(3)17-11-13(2)10-15(4)22(17)27-20)24(30)28-25-21(23(26)29)16-8-6-7-9-19(16)32-25/h10-12,18H,5-9H2,1-4H3,(H2,26,29)(H,28,30) |
| InChIKey | SUVISMBQJNIYDF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |