C17H16Cl3NOS — CID 2113740
(2S)-2-(3,4-dimethylphenyl)sulfanyl-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 2113740) has the molecular formula C17H16Cl3NOS and a molecular weight of 388.75 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethylphenyl)sulfanyl-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | (2S)-2-(3,4-dimethylphenyl)sulfanyl-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 2113740 |
| Molecular Formula | C17H16Cl3NOS |
| Molecular Weight | 388.75 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | (2S)-2-(3,4-dimethylphenyl)sulfanyl-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | Cc1ccc(S[C@@H](C)C(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1C |
| InChI | InChI=1S/C17H16Cl3NOS/c1-9-4-5-12(6-10(9)2)23-11(3)17(22)21-16-8-14(19)13(18)7-15(16)20/h4-8,11H,1-3H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | DZPKGLZQZNCZMY-NSHDSACASA-N |
| XLogP | 6.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.75 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|