C22H14N2O5S — CID 5140026
2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-5-nitrobenzoic acid (PubChem CID 5140026) has the molecular formula C22H14N2O5S and a molecular weight of 418.43 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-5-nitrobenzoic acid.
| Compound Name | 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 5140026 |
| Molecular Formula | C22H14N2O5S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-5-nitrobenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1Sc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C22H14N2O5S/c25-21(26)17-13-16(24(27)28)11-12-18(17)30-22-23-19(14-7-3-1-4-8-14)20(29-22)15-9-5-2-6-10-15/h1-13H,(H,25,26) |
| InChIKey | MXXNRVXQHOFXPD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|