C15H10N2O3 — CID 12873125
2-nitro-4,5-diphenyl-1,3-oxazole (PubChem CID 12873125) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 2-nitro-4,5-diphenyl-1,3-oxazole.
| Compound Name | 2-nitro-4,5-diphenyl-1,3-oxazole |
|---|---|
| PubChem CID | 12873125 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-nitro-4,5-diphenyl-1,3-oxazole |
| SMILES | O=[N+]([O-])c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C15H10N2O3/c18-17(19)15-16-13(11-7-3-1-4-8-11)14(20-15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | VTEBZKGRVQUIPC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|