C26H24N4O3 — CID 126494855
2-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-4,5-diphenyl-1,3-oxazole (PubChem CID 126494855) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-4,5-diphenyl-1,3-oxazole.
| Compound Name | 2-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-4,5-diphenyl-1,3-oxazole |
|---|---|
| PubChem CID | 126494855 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-4,5-diphenyl-1,3-oxazole |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(Cc3nc(-c4ccccc4)c(-c4ccccc4)o3)CC2)cc1 |
| InChI | InChI=1S/C26H24N4O3/c31-30(32)23-13-11-22(12-14-23)29-17-15-28(16-18-29)19-24-27-25(20-7-3-1-4-8-20)26(33-24)21-9-5-2-6-10-21/h1-14H,15-19H2 |
| InChIKey | XOFGPMOPFWDUDQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 75.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|