C16H16Cl2N4O2 — CID 55987768
1-[(2,6-dichloro-4-pyridinyl)methyl]-4-(4-nitrophenyl)piperazine (PubChem CID 55987768) has the molecular formula C16H16Cl2N4O2 and a molecular weight of 367.24 g/mol. Its IUPAC name is 1-[(2,6-dichloro-4-pyridinyl)methyl]-4-(4-nitrophenyl)piperazine.
| Compound Name | 1-[(2,6-dichloro-4-pyridinyl)methyl]-4-(4-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 55987768 |
| Molecular Formula | C16H16Cl2N4O2 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1-[(2,6-dichloro-4-pyridinyl)methyl]-4-(4-nitrophenyl)piperazine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(Cc3cc(Cl)nc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C16H16Cl2N4O2/c17-15-9-12(10-16(18)19-15)11-20-5-7-21(8-6-20)13-1-3-14(4-2-13)22(23)24/h1-4,9-10H,5-8,11H2 |
| InChIKey | BPNOTKLFTVFSGT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|