C22H26Cl2N6O2 — CID 89218547
N'-[2,6-dichloro-4-(pyrrolidin-1-ylmethyl)phenyl]-4-(4-nitrophenyl)piperazine-1-carboximidamide (PubChem CID 89218547) has the molecular formula C22H26Cl2N6O2 and a molecular weight of 477.40 g/mol. Its IUPAC name is N'-[2,6-dichloro-4-(pyrrolidin-1-ylmethyl)phenyl]-4-(4-nitrophenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[2,6-dichloro-4-(pyrrolidin-1-ylmethyl)phenyl]-4-(4-nitrophenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 89218547 |
| Molecular Formula | C22H26Cl2N6O2 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N'-[2,6-dichloro-4-(pyrrolidin-1-ylmethyl)phenyl]-4-(4-nitrophenyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\c1c(Cl)cc(CN2CCCC2)cc1Cl)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C22H26Cl2N6O2/c23-19-13-16(15-27-7-1-2-8-27)14-20(24)21(19)26-22(25)29-11-9-28(10-12-29)17-3-5-18(6-4-17)30(31)32/h3-6,13-14H,1-2,7-12,15H2,(H2,25,26) |
| InChIKey | CZVCVBLQZVJQKH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|