C22H25Cl2N5O3 — CID 59446793
N-[2,6-dichloro-4-(pyrrolidin-1-ylmethyl)phenyl]-4-(4-nitrophenyl)piperazine-1-carboxamide (PubChem CID 59446793) has the molecular formula C22H25Cl2N5O3 and a molecular weight of 478.38 g/mol. Its IUPAC name is N-[2,6-dichloro-4-(pyrrolidin-1-ylmethyl)phenyl]-4-(4-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | N-[2,6-dichloro-4-(pyrrolidin-1-ylmethyl)phenyl]-4-(4-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 59446793 |
| Molecular Formula | C22H25Cl2N5O3 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | N-[2,6-dichloro-4-(pyrrolidin-1-ylmethyl)phenyl]-4-(4-nitrophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1c(Cl)cc(CN2CCCC2)cc1Cl)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C22H25Cl2N5O3/c23-19-13-16(15-26-7-1-2-8-26)14-20(24)21(19)25-22(30)28-11-9-27(10-12-28)17-3-5-18(6-4-17)29(31)32/h3-6,13-14H,1-2,7-12,15H2,(H,25,30) |
| InChIKey | WHBLKTIRTRPKSV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|