C17H16F2N4O3 — CID 2955750
N-(2,4-difluorophenyl)-4-(4-nitrophenyl)piperazine-1-carboxamide (PubChem CID 2955750) has the molecular formula C17H16F2N4O3 and a molecular weight of 362.34 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(4-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-4-(4-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 2955750 |
| Molecular Formula | C17H16F2N4O3 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(4-nitrophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C17H16F2N4O3/c18-12-1-6-16(15(19)11-12)20-17(24)22-9-7-21(8-10-22)13-2-4-14(5-3-13)23(25)26/h1-6,11H,7-10H2,(H,20,24) |
| InChIKey | XJESDGWHZKINDF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|