C21H25F2N3O — CID 113112680
4-(4-tert-butylphenyl)-N-(2,4-difluorophenyl)piperazine-1-carboxamide (PubChem CID 113112680) has the molecular formula C21H25F2N3O and a molecular weight of 373.45 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-N-(2,4-difluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(4-tert-butylphenyl)-N-(2,4-difluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113112680 |
| Molecular Formula | C21H25F2N3O |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-(4-tert-butylphenyl)-N-(2,4-difluorophenyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(N2CCN(C(=O)Nc3ccc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C21H25F2N3O/c1-21(2,3)15-4-7-17(8-5-15)25-10-12-26(13-11-25)20(27)24-19-9-6-16(22)14-18(19)23/h4-9,14H,10-13H2,1-3H3,(H,24,27) |
| InChIKey | HRVHYWTWMFXCGT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |