C18H18F3N3O — CID 70949261
4-(4-methylphenyl)-N-(2,4,6-trifluorophenyl)piperazine-1-carboxamide (PubChem CID 70949261) has the molecular formula C18H18F3N3O and a molecular weight of 349.36 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-(2,4,6-trifluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(4-methylphenyl)-N-(2,4,6-trifluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 70949261 |
| Molecular Formula | C18H18F3N3O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 4-(4-methylphenyl)-N-(2,4,6-trifluorophenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(N2CCN(C(=O)Nc3c(F)cc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C18H18F3N3O/c1-12-2-4-14(5-3-12)23-6-8-24(9-7-23)18(25)22-17-15(20)10-13(19)11-16(17)21/h2-5,10-11H,6-9H2,1H3,(H,22,25) |
| InChIKey | KISZDSSQHOJRNR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|