C16H11F2NO — CID 18701609
2-(difluoromethyl)-4,5-diphenyl-1,3-oxazole (PubChem CID 18701609) has the molecular formula C16H11F2NO and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-(difluoromethyl)-4,5-diphenyl-1,3-oxazole.
| Compound Name | 2-(difluoromethyl)-4,5-diphenyl-1,3-oxazole |
|---|---|
| PubChem CID | 18701609 |
| Molecular Formula | C16H11F2NO |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-(difluoromethyl)-4,5-diphenyl-1,3-oxazole |
| SMILES | FC(F)c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H11F2NO/c17-15(18)16-19-13(11-7-3-1-4-8-11)14(20-16)12-9-5-2-6-10-12/h1-10,15H |
| InChIKey | NFIMYWFODPZUIM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |