C18H16N2O3 — CID 102486232
(2S,3S)-2-acetyl-4-nitro-2,3-diphenylbutanenitrile (PubChem CID 102486232) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is (2S,3S)-2-acetyl-4-nitro-2,3-diphenylbutanenitrile.
| Compound Name | (2S,3S)-2-acetyl-4-nitro-2,3-diphenylbutanenitrile |
|---|---|
| PubChem CID | 102486232 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (2S,3S)-2-acetyl-4-nitro-2,3-diphenylbutanenitrile |
| SMILES | CC(=O)[C@](C#N)(c1ccccc1)[C@@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H16N2O3/c1-14(21)18(13-19,16-10-6-3-7-11-16)17(12-20(22)23)15-8-4-2-5-9-15/h2-11,17H,12H2,1H3/t17-,18+/m0/s1 |
| InChIKey | IFUYJWPRQSRISJ-ZWKOTPCHSA-N |
| XLogP | 3.10 |
| TPSA | 84.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|