C21H19FN2O4 — CID 122386457
4-[(2R,3S)-3-benzoyl-3-fluoro-5-methyl-1-nitro-4-oxohexan-2-yl]benzonitrile (PubChem CID 122386457) has the molecular formula C21H19FN2O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is 4-[(2R,3S)-3-benzoyl-3-fluoro-5-methyl-1-nitro-4-oxohexan-2-yl]benzonitrile.
| Compound Name | 4-[(2R,3S)-3-benzoyl-3-fluoro-5-methyl-1-nitro-4-oxohexan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 122386457 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 4-[(2R,3S)-3-benzoyl-3-fluoro-5-methyl-1-nitro-4-oxohexan-2-yl]benzonitrile |
| SMILES | CC(C)C(=O)[C@](F)(C(=O)c1ccccc1)[C@@H](C[N+](=O)[O-])c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H19FN2O4/c1-14(2)19(25)21(22,20(26)17-6-4-3-5-7-17)18(13-24(27)28)16-10-8-15(12-23)9-11-16/h3-11,14,18H,13H2,1-2H3/t18-,21-/m0/s1 |
| InChIKey | RWGDJIRSKZZHNS-RXVVDRJESA-N |
| XLogP | 3.73 |
| TPSA | 101.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|