C20H22F2NO6P — CID 122383106
(2R,3S)-2-diethoxyphosphoryl-2-fluoro-3-(4-fluorophenyl)-4-nitro-1-phenylbutan-1-one (PubChem CID 122383106) has the molecular formula C20H22F2NO6P and a molecular weight of 441.37 g/mol. Its IUPAC name is (2R,3S)-2-diethoxyphosphoryl-2-fluoro-3-(4-fluorophenyl)-4-nitro-1-phenylbutan-1-one.
| Compound Name | (2R,3S)-2-diethoxyphosphoryl-2-fluoro-3-(4-fluorophenyl)-4-nitro-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 122383106 |
| Molecular Formula | C20H22F2NO6P |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | (2R,3S)-2-diethoxyphosphoryl-2-fluoro-3-(4-fluorophenyl)-4-nitro-1-phenylbutan-1-one |
| SMILES | CCOP(=O)(OCC)[C@@](F)(C(=O)c1ccccc1)[C@H](C[N+](=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22F2NO6P/c1-3-28-30(27,29-4-2)20(22,19(24)16-8-6-5-7-9-16)18(14-23(25)26)15-10-12-17(21)13-11-15/h5-13,18H,3-4,14H2,1-2H3/t18-,20-/m1/s1 |
| InChIKey | OVJUCXOZXKJNRK-UYAOXDASSA-N |
| XLogP | 5.00 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|