C13H13F2NO5 — CID 101468424
methyl (2R,3S)-2-acetyl-2-fluoro-3-(4-fluorophenyl)-4-nitrobutanoate (PubChem CID 101468424) has the molecular formula C13H13F2NO5 and a molecular weight of 301.25 g/mol. Its IUPAC name is methyl (2R,3S)-2-acetyl-2-fluoro-3-(4-fluorophenyl)-4-nitrobutanoate.
| Compound Name | methyl (2R,3S)-2-acetyl-2-fluoro-3-(4-fluorophenyl)-4-nitrobutanoate |
|---|---|
| PubChem CID | 101468424 |
| Molecular Formula | C13H13F2NO5 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | methyl (2R,3S)-2-acetyl-2-fluoro-3-(4-fluorophenyl)-4-nitrobutanoate |
| SMILES | COC(=O)[C@](F)(C(C)=O)[C@H](C[N+](=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C13H13F2NO5/c1-8(17)13(15,12(18)21-2)11(7-16(19)20)9-3-5-10(14)6-4-9/h3-6,11H,7H2,1-2H3/t11-,13+/m1/s1 |
| InChIKey | KFWMDUXKXKWLNY-YPMHNXCESA-N |
| XLogP | 1.66 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|