C27H26FNO7S — CID 102335165
(4-methoxyphenyl)methyl 3-(4-fluorophenyl)-2-(4-methoxyphenyl)sulfanylcarbonyl-2-methyl-4-nitrobutanoate (PubChem CID 102335165) has the molecular formula C27H26FNO7S and a molecular weight of 527.57 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 3-(4-fluorophenyl)-2-(4-methoxyphenyl)sulfanylcarbonyl-2-methyl-4-nitrobutanoate.
| Compound Name | (4-methoxyphenyl)methyl 3-(4-fluorophenyl)-2-(4-methoxyphenyl)sulfanylcarbonyl-2-methyl-4-nitrobutanoate |
|---|---|
| PubChem CID | 102335165 |
| Molecular Formula | C27H26FNO7S |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | (4-methoxyphenyl)methyl 3-(4-fluorophenyl)-2-(4-methoxyphenyl)sulfanylcarbonyl-2-methyl-4-nitrobutanoate |
| SMILES | COc1ccc(COC(=O)C(C)(C(=O)Sc2ccc(OC)cc2)C(C[N+](=O)[O-])c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H26FNO7S/c1-27(26(31)37-23-14-12-22(35-3)13-15-23,24(16-29(32)33)19-6-8-20(28)9-7-19)25(30)36-17-18-4-10-21(34-2)11-5-18/h4-15,24H,16-17H2,1-3H3 |
| InChIKey | IBIAXNCIUFAAEA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|