C20H19ClFNO5 — CID 101474420
propan-2-yl (2S,3R)-2-(3-chlorobenzoyl)-2-fluoro-4-nitro-3-phenylbutanoate (PubChem CID 101474420) has the molecular formula C20H19ClFNO5 and a molecular weight of 407.83 g/mol. Its IUPAC name is propan-2-yl (2S,3R)-2-(3-chlorobenzoyl)-2-fluoro-4-nitro-3-phenylbutanoate.
| Compound Name | propan-2-yl (2S,3R)-2-(3-chlorobenzoyl)-2-fluoro-4-nitro-3-phenylbutanoate |
|---|---|
| PubChem CID | 101474420 |
| Molecular Formula | C20H19ClFNO5 |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | propan-2-yl (2S,3R)-2-(3-chlorobenzoyl)-2-fluoro-4-nitro-3-phenylbutanoate |
| SMILES | CC(C)OC(=O)[C@@](F)(C(=O)c1cccc(Cl)c1)[C@@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C20H19ClFNO5/c1-13(2)28-19(25)20(22,18(24)15-9-6-10-16(21)11-15)17(12-23(26)27)14-7-4-3-5-8-14/h3-11,13,17H,12H2,1-2H3/t17-,20-/m0/s1 |
| InChIKey | DLSPSEDPVQIDCS-PXNSSMCTSA-N |
| XLogP | 4.24 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|