C15H21NO4 — CID 102216457
ethyl (2R,3R)-2-ethyl-2-methyl-4-nitro-3-phenylbutanoate (PubChem CID 102216457) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is ethyl (2R,3R)-2-ethyl-2-methyl-4-nitro-3-phenylbutanoate.
| Compound Name | ethyl (2R,3R)-2-ethyl-2-methyl-4-nitro-3-phenylbutanoate |
|---|---|
| PubChem CID | 102216457 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | ethyl (2R,3R)-2-ethyl-2-methyl-4-nitro-3-phenylbutanoate |
| SMILES | CCOC(=O)[C@](C)(CC)[C@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C15H21NO4/c1-4-15(3,14(17)20-5-2)13(11-16(18)19)12-9-7-6-8-10-12/h6-10,13H,4-5,11H2,1-3H3/t13-,15-/m1/s1 |
| InChIKey | WQKXABTUMUWVCX-UKRRQHHQSA-N |
| XLogP | 3.03 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|