C20H28N2O8 — CID 11418836
diethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-nitro-1-phenylethyl)propanedioate (PubChem CID 11418836) has the molecular formula C20H28N2O8 and a molecular weight of 424.45 g/mol. Its IUPAC name is diethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-nitro-1-phenylethyl)propanedioate.
| Compound Name | diethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-nitro-1-phenylethyl)propanedioate |
|---|---|
| PubChem CID | 11418836 |
| Molecular Formula | C20H28N2O8 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | diethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-nitro-1-phenylethyl)propanedioate |
| SMILES | CCOC(=O)C(NC(=O)OC(C)(C)C)(C(=O)OCC)C(C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C20H28N2O8/c1-6-28-16(23)20(17(24)29-7-2,21-18(25)30-19(3,4)5)15(13-22(26)27)14-11-9-8-10-12-14/h8-12,15H,6-7,13H2,1-5H3,(H,21,25) |
| InChIKey | SUCNDYSXISZDMI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|