C23H30N2O3S — CID 166441535
(NZ,R)-N-[(2S,3S)-2-ethyl-2-methyl-4-nitro-1,3-diphenylbutylidene]-2-methylpropane-2-sulfinamide (PubChem CID 166441535) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is (NZ,R)-N-[(2S,3S)-2-ethyl-2-methyl-4-nitro-1,3-diphenylbutylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ,R)-N-[(2S,3S)-2-ethyl-2-methyl-4-nitro-1,3-diphenylbutylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 166441535 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (NZ,R)-N-[(2S,3S)-2-ethyl-2-methyl-4-nitro-1,3-diphenylbutylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC[C@](C)(/C(=N/[S@](=O)C(C)(C)C)c1ccccc1)[C@@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-6-23(5,20(17-25(26)27)18-13-9-7-10-14-18)21(19-15-11-8-12-16-19)24-29(28)22(2,3)4/h7-16,20H,6,17H2,1-5H3/b24-21+/t20-,23-,29+/m0/s1 |
| InChIKey | FCPBIVFBHVXTRT-IRUPAJMCSA-N |
| XLogP | 5.41 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|