C15H23NOS — CID 123778184
(S)-N-(2,2-dimethyl-1-phenylpropylidene)-2-methylpropane-2-sulfinamide (PubChem CID 123778184) has the molecular formula C15H23NOS and a molecular weight of 265.42 g/mol. Its IUPAC name is (S)-N-(2,2-dimethyl-1-phenylpropylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-(2,2-dimethyl-1-phenylpropylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 123778184 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (S)-N-(2,2-dimethyl-1-phenylpropylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)C(=N[S@@](=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H23NOS/c1-14(2,3)13(12-10-8-7-9-11-12)16-18(17)15(4,5)6/h7-11H,1-6H3/t18-/m0/s1 |
| InChIKey | PDCJXJDEHWPHOQ-SFHVURJKSA-N |
| XLogP | 3.98 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|