C13H16F3NO2S — CID 71560122
(NZ,S)-2-methyl-N-[2,2,2-trifluoro-1-(2-methoxyphenyl)ethylidene]propane-2-sulfinamide (PubChem CID 71560122) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is (NZ,S)-2-methyl-N-[2,2,2-trifluoro-1-(2-methoxyphenyl)ethylidene]propane-2-sulfinamide.
| Compound Name | (NZ,S)-2-methyl-N-[2,2,2-trifluoro-1-(2-methoxyphenyl)ethylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 71560122 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | (NZ,S)-2-methyl-N-[2,2,2-trifluoro-1-(2-methoxyphenyl)ethylidene]propane-2-sulfinamide |
| SMILES | COc1ccccc1/C(=N/[S@@](=O)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO2S/c1-12(2,3)20(18)17-11(13(14,15)16)9-7-5-6-8-10(9)19-4/h5-8H,1-4H3/b17-11-/t20-/m0/s1 |
| InChIKey | KCWXLOAKBBISOX-OWMRDYPQSA-N |
| XLogP | 3.51 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|