C13H16F3NOS — CID 135077950
(NE,R)-2-methyl-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]propane-2-sulfinamide (PubChem CID 135077950) has the molecular formula C13H16F3NOS and a molecular weight of 291.34 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 135077950 |
| Molecular Formula | C13H16F3NOS |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (NE,R)-2-methyl-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]propane-2-sulfinamide |
| SMILES | Cc1ccc(/C(=N\[S@](=O)C(C)(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3NOS/c1-9-5-7-10(8-6-9)11(13(14,15)16)17-19(18)12(2,3)4/h5-8H,1-4H3/b17-11+/t19-/m1/s1 |
| InChIKey | JYVWHDJYWKBNBK-GTENMVSRSA-N |
| XLogP | 3.81 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|