C12H12BrF4NOS — CID 86715725
(R)-N-[1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 86715725) has the molecular formula C12H12BrF4NOS and a molecular weight of 374.20 g/mol. Its IUPAC name is (R)-N-[1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 86715725 |
| Molecular Formula | C12H12BrF4NOS |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | (R)-N-[1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N=C(c1cc(Br)ccc1F)C(F)(F)F |
| InChI | InChI=1S/C12H12BrF4NOS/c1-11(2,3)20(19)18-10(12(15,16)17)8-6-7(13)4-5-9(8)14/h4-6H,1-3H3/t20-/m1/s1 |
| InChIKey | HJWGTWVCGBXBML-HXUWFJFHSA-N |
| XLogP | 4.40 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|