C12H13BrF3NOS — CID 87096337
(NZ)-N-[1-(5-bromo-2-fluorophenyl)-2,2-difluoroethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 87096337) has the molecular formula C12H13BrF3NOS and a molecular weight of 356.21 g/mol. Its IUPAC name is (NZ)-N-[1-(5-bromo-2-fluorophenyl)-2,2-difluoroethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ)-N-[1-(5-bromo-2-fluorophenyl)-2,2-difluoroethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 87096337 |
| Molecular Formula | C12H13BrF3NOS |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | (NZ)-N-[1-(5-bromo-2-fluorophenyl)-2,2-difluoroethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)/N=C(/c1cc(Br)ccc1F)C(F)F |
| InChI | InChI=1S/C12H13BrF3NOS/c1-12(2,3)19(18)17-10(11(15)16)8-6-7(13)4-5-9(8)14/h4-6,11H,1-3H3/b17-10- |
| InChIKey | SHUUCBJTGZSYOE-YVLHZVERSA-N |
| XLogP | 4.10 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|