C19H29BrF3NO2SSi — CID 86650272
N-[1-(5-bromo-2-fluorophenyl)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropylidene]-2-methylpropane-2-sulfinamide (PubChem CID 86650272) has the molecular formula C19H29BrF3NO2SSi and a molecular weight of 500.50 g/mol. Its IUPAC name is N-[1-(5-bromo-2-fluorophenyl)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-(5-bromo-2-fluorophenyl)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 86650272 |
| Molecular Formula | C19H29BrF3NO2SSi |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | N-[1-(5-bromo-2-fluorophenyl)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N=C(c1cc(Br)ccc1F)C(F)(F)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H29BrF3NO2SSi/c1-17(2,3)27(25)24-16(14-11-13(20)9-10-15(14)21)19(22,23)12-26-28(7,8)18(4,5)6/h9-11H,12H2,1-8H3 |
| InChIKey | OKOVKHGBRBHJBY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|