C15H22BrFO4Si — CID 172790117
(2S)-2-(5-bromo-2-fluorophenoxy)-3-[tert-butyl(dimethyl)silyl]oxypropanoic acid (PubChem CID 172790117) has the molecular formula C15H22BrFO4Si and a molecular weight of 393.33 g/mol. Its IUPAC name is (2S)-2-(5-bromo-2-fluorophenoxy)-3-[tert-butyl(dimethyl)silyl]oxypropanoic acid.
| Compound Name | (2S)-2-(5-bromo-2-fluorophenoxy)-3-[tert-butyl(dimethyl)silyl]oxypropanoic acid |
|---|---|
| PubChem CID | 172790117 |
| Molecular Formula | C15H22BrFO4Si |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | (2S)-2-(5-bromo-2-fluorophenoxy)-3-[tert-butyl(dimethyl)silyl]oxypropanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](Oc1cc(Br)ccc1F)C(=O)O |
| InChI | InChI=1S/C15H22BrFO4Si/c1-15(2,3)22(4,5)20-9-13(14(18)19)21-12-8-10(16)6-7-11(12)17/h6-8,13H,9H2,1-5H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | PLJVAPQNHKMCFE-ZDUSSCGKSA-N |
| XLogP | 4.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|